C27H36ClN3O3 — CID 150168161
3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-2-hydroxy-4-octylphenyl]propanoic acid (PubChem CID 150168161) has the molecular formula C27H36ClN3O3 and a molecular weight of 486.06 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-2-hydroxy-4-octylphenyl]propanoic acid.
| Compound Name | 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-2-hydroxy-4-octylphenyl]propanoic acid |
|---|---|
| PubChem CID | 150168161 |
| Molecular Formula | C27H36ClN3O3 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-2-hydroxy-4-octylphenyl]propanoic acid |
| SMILES | CCCCCCCCc1c(-n2nc3ccc(Cl)cc3n2)cc(CCC(=O)O)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C27H36ClN3O3/c1-5-6-7-8-9-10-11-20-23(31-29-21-14-13-19(28)17-22(21)30-31)16-18(12-15-24(32)33)26(34)25(20)27(2,3)4/h13-14,16-17,34H,5-12,15H2,1-4H3,(H,32,33) |
| InChIKey | FIVRUYNGKNYIGY-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|