C16H18ClNO4S — CID 141138310
3-(3-hydroxypropylsulfonyl)-4-phenylbenzamide;hydrochloride (PubChem CID 141138310) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is 3-(3-hydroxypropylsulfonyl)-4-phenylbenzamide;hydrochloride.
| Compound Name | 3-(3-hydroxypropylsulfonyl)-4-phenylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 141138310 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 3-(3-hydroxypropylsulfonyl)-4-phenylbenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(-c2ccccc2)c(S(=O)(=O)CCCO)c1 |
| InChI | InChI=1S/C16H17NO4S.ClH/c17-16(19)13-7-8-14(12-5-2-1-3-6-12)15(11-13)22(20,21)10-4-9-18;/h1-3,5-8,11,18H,4,9-10H2,(H2,17,19);1H |
| InChIKey | TUNYJKHOAVNEFU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |