C15H16F3N3O — CID 141138972
1-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-5-(trifluoromethoxy)indazole (PubChem CID 141138972) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is 1-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-5-(trifluoromethoxy)indazole.
| Compound Name | 1-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-5-(trifluoromethoxy)indazole |
|---|---|
| PubChem CID | 141138972 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-5-(trifluoromethoxy)indazole |
| SMILES | CN1CC2CC1CC2n1ncc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H16F3N3O/c1-20-8-10-4-11(20)6-14(10)21-13-3-2-12(22-15(16,17)18)5-9(13)7-19-21/h2-3,5,7,10-11,14H,4,6,8H2,1H3 |
| InChIKey | UHWJSEGQGJSKIM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |