C18H20F3N3O4 — CID 157099026
formic acid;2-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1-[5-(trifluoromethoxy)-1H-indazol-3-yl]ethanone (PubChem CID 157099026) has the molecular formula C18H20F3N3O4 and a molecular weight of 399.37 g/mol. Its IUPAC name is formic acid;2-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1-[5-(trifluoromethoxy)-1H-indazol-3-yl]ethanone.
| Compound Name | formic acid;2-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1-[5-(trifluoromethoxy)-1H-indazol-3-yl]ethanone |
|---|---|
| PubChem CID | 157099026 |
| Molecular Formula | C18H20F3N3O4 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | formic acid;2-(2-methyl-2-azabicyclo[2.2.1]heptan-5-yl)-1-[5-(trifluoromethoxy)-1H-indazol-3-yl]ethanone |
| SMILES | CN1CC2CC1CC2CC(=O)c1n[nH]c2ccc(OC(F)(F)F)cc12.O=CO |
| InChI | InChI=1S/C17H18F3N3O2.CH2O2/c1-23-8-10-5-11(23)4-9(10)6-15(24)16-13-7-12(25-17(18,19)20)2-3-14(13)21-22-16;2-1-3/h2-3,7,9-11H,4-6,8H2,1H3,(H,21,22);1H,(H,2,3) |
| InChIKey | AFNXLNAGLQYRIN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|