C18H12ClN5S — CID 141139183
1-(4-chlorophenyl)-N-[4-phenyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine (PubChem CID 141139183) has the molecular formula C18H12ClN5S and a molecular weight of 365.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-phenyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[4-phenyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 141139183 |
| Molecular Formula | C18H12ClN5S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-phenyl-5-(1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]methanimine |
| SMILES | Clc1ccc(C=Nc2nc(-c3ccccc3)c(-n3cncn3)s2)cc1 |
| InChI | InChI=1S/C18H12ClN5S/c19-15-8-6-13(7-9-15)10-21-18-23-16(14-4-2-1-3-5-14)17(25-18)24-12-20-11-22-24/h1-12H |
| InChIKey | RABXCLKXCUUQAD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|