C12H16N2OS — CID 141143649
5-phenyl-2-propan-2-yl-1,3,5-thiadiazinan-4-one (PubChem CID 141143649) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 5-phenyl-2-propan-2-yl-1,3,5-thiadiazinan-4-one.
| Compound Name | 5-phenyl-2-propan-2-yl-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 141143649 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 5-phenyl-2-propan-2-yl-1,3,5-thiadiazinan-4-one |
| SMILES | CC(C)C1NC(=O)N(c2ccccc2)CS1 |
| InChI | InChI=1S/C12H16N2OS/c1-9(2)11-13-12(15)14(8-16-11)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,13,15) |
| InChIKey | VVTWXMFUWPYGEE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |