C15H14N2S2 — CID 20813296
2,5-diphenyl-1,3,5-thiadiazinane-4-thione (PubChem CID 20813296) has the molecular formula C15H14N2S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 2,5-diphenyl-1,3,5-thiadiazinane-4-thione.
| Compound Name | 2,5-diphenyl-1,3,5-thiadiazinane-4-thione |
|---|---|
| PubChem CID | 20813296 |
| Molecular Formula | C15H14N2S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2,5-diphenyl-1,3,5-thiadiazinane-4-thione |
| SMILES | S=C1NC(c2ccccc2)SCN1c1ccccc1 |
| InChI | InChI=1S/C15H14N2S2/c18-15-16-14(12-7-3-1-4-8-12)19-11-17(15)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,18) |
| InChIKey | ZZIALQWPGJVMTO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|