C10H11NS2 — CID 11401554
(7R)-7-phenyl-3,5-dithia-1-azabicyclo[2.2.1]heptane (PubChem CID 11401554) has the molecular formula C10H11NS2 and a molecular weight of 209.34 g/mol. Its IUPAC name is (7R)-7-phenyl-3,5-dithia-1-azabicyclo[2.2.1]heptane.
| Compound Name | (7R)-7-phenyl-3,5-dithia-1-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11401554 |
| Molecular Formula | C10H11NS2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | (7R)-7-phenyl-3,5-dithia-1-azabicyclo[2.2.1]heptane |
| SMILES | c1ccc([C@@H]2C3SCN2CS3)cc1 |
| InChI | InChI=1S/C10H11NS2/c1-2-4-8(5-3-1)9-10-12-6-11(9)7-13-10/h1-5,9-10H,6-7H2/t9-/m1/s1 |
| InChIKey | ASEKDYUQAQHOIR-SECBINFHSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |