C10H12N2O2S — CID 173069281
6-phenyl-2,3,6,8-tetrahydro-[1,3,4]thiadiazolo[3,4-b][1,4,2,3]dioxadiazine (PubChem CID 173069281) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 6-phenyl-2,3,6,8-tetrahydro-[1,3,4]thiadiazolo[3,4-b][1,4,2,3]dioxadiazine.
| Compound Name | 6-phenyl-2,3,6,8-tetrahydro-[1,3,4]thiadiazolo[3,4-b][1,4,2,3]dioxadiazine |
|---|---|
| PubChem CID | 173069281 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 6-phenyl-2,3,6,8-tetrahydro-[1,3,4]thiadiazolo[3,4-b][1,4,2,3]dioxadiazine |
| SMILES | c1ccc(C2SCN3OCCON23)cc1 |
| InChI | InChI=1S/C10H12N2O2S/c1-2-4-9(5-3-1)10-12-11(8-15-10)13-6-7-14-12/h1-5,10H,6-8H2 |
| InChIKey | BERQEABLGDKVSJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |