C10H12ClNS — CID 174266525
5-chloro-3-methyl-2-phenyl-1,3-thiazolidine (PubChem CID 174266525) has the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. Its IUPAC name is 5-chloro-3-methyl-2-phenyl-1,3-thiazolidine.
| Compound Name | 5-chloro-3-methyl-2-phenyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 174266525 |
| Molecular Formula | C10H12ClNS |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 5-chloro-3-methyl-2-phenyl-1,3-thiazolidine |
| SMILES | CN1CC(Cl)SC1c1ccccc1 |
| InChI | InChI=1S/C10H12ClNS/c1-12-7-9(11)13-10(12)8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3 |
| InChIKey | QSYFRIHVFOVIKN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|