C9H9N2S2- — CID 20734793
3-methyl-2-phenyl-2H-1,3,4-thiadiazole-5-thiolate (PubChem CID 20734793) has the molecular formula C9H9N2S2- and a molecular weight of 209.32 g/mol. Its IUPAC name is 3-methyl-2-phenyl-2H-1,3,4-thiadiazole-5-thiolate.
| Compound Name | 3-methyl-2-phenyl-2H-1,3,4-thiadiazole-5-thiolate |
|---|---|
| PubChem CID | 20734793 |
| Molecular Formula | C9H9N2S2- |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 3-methyl-2-phenyl-2H-1,3,4-thiadiazole-5-thiolate |
| SMILES | CN1N=C([S-])SC1c1ccccc1 |
| InChI | InChI=1S/C9H10N2S2/c1-11-8(13-9(12)10-11)7-5-3-2-4-6-7/h2-6,8H,1H3,(H,10,12)/p-1 |
| InChIKey | RAZHFKPJWJBELL-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|