C18H21NO2S — CID 14297046
3-ethyl-6,7-dimethoxy-2-phenyl-2,4-dihydro-1,3-benzothiazine (PubChem CID 14297046) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-ethyl-6,7-dimethoxy-2-phenyl-2,4-dihydro-1,3-benzothiazine.
| Compound Name | 3-ethyl-6,7-dimethoxy-2-phenyl-2,4-dihydro-1,3-benzothiazine |
|---|---|
| PubChem CID | 14297046 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-ethyl-6,7-dimethoxy-2-phenyl-2,4-dihydro-1,3-benzothiazine |
| SMILES | CCN1Cc2cc(OC)c(OC)cc2SC1c1ccccc1 |
| InChI | InChI=1S/C18H21NO2S/c1-4-19-12-14-10-15(20-2)16(21-3)11-17(14)22-18(19)13-8-6-5-7-9-13/h5-11,18H,4,12H2,1-3H3 |
| InChIKey | LVSSGLMTHHAPHU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |