C14H13N2S2- — CID 23542982
4,5-diphenyl-1,3,4-thiadiazolidine-2-thiolate (PubChem CID 23542982) has the molecular formula C14H13N2S2- and a molecular weight of 273.41 g/mol. Its IUPAC name is 4,5-diphenyl-1,3,4-thiadiazolidine-2-thiolate.
| Compound Name | 4,5-diphenyl-1,3,4-thiadiazolidine-2-thiolate |
|---|---|
| PubChem CID | 23542982 |
| Molecular Formula | C14H13N2S2- |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4,5-diphenyl-1,3,4-thiadiazolidine-2-thiolate |
| SMILES | [S-]C1NN(c2ccccc2)C(c2ccccc2)S1 |
| InChI | InChI=1S/C14H14N2S2/c17-14-15-16(12-9-5-2-6-10-12)13(18-14)11-7-3-1-4-8-11/h1-10,13-15,17H/p-1 |
| InChIKey | TYXBSXLBBPINFN-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|