C10H9ClF3NS — CID 174269759
4-chloro-2-phenyl-3-(trifluoromethyl)-1,3-thiazolidine (PubChem CID 174269759) has the molecular formula C10H9ClF3NS and a molecular weight of 267.70 g/mol. Its IUPAC name is 4-chloro-2-phenyl-3-(trifluoromethyl)-1,3-thiazolidine.
| Compound Name | 4-chloro-2-phenyl-3-(trifluoromethyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 174269759 |
| Molecular Formula | C10H9ClF3NS |
| Molecular Weight | 267.70 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 4-chloro-2-phenyl-3-(trifluoromethyl)-1,3-thiazolidine |
| SMILES | FC(F)(F)N1C(Cl)CSC1c1ccccc1 |
| InChI | InChI=1S/C10H9ClF3NS/c11-8-6-16-9(15(8)10(12,13)14)7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | ULLKLJKUWFOFIA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|