C11H10N2OS2 — CID 102330329
3-phenyl-2-sulfanylidene-5-(thiiran-2-yl)imidazolidin-4-one (PubChem CID 102330329) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-phenyl-2-sulfanylidene-5-(thiiran-2-yl)imidazolidin-4-one.
| Compound Name | 3-phenyl-2-sulfanylidene-5-(thiiran-2-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 102330329 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 3-phenyl-2-sulfanylidene-5-(thiiran-2-yl)imidazolidin-4-one |
| SMILES | O=C1C(C2CS2)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C11H10N2OS2/c14-10-9(8-6-16-8)12-11(15)13(10)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,12,15) |
| InChIKey | OVSWFPPZLSTTDG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|