C15H25OP — CID 141144143
2,4,4-trimethyl-3-[(2E,4E)-3-methyl-5-phosphanylpenta-2,4-dienyl]cyclohex-2-en-1-ol (PubChem CID 141144143) has the molecular formula C15H25OP and a molecular weight of 252.34 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[(2E,4E)-3-methyl-5-phosphanylpenta-2,4-dienyl]cyclohex-2-en-1-ol.
| Compound Name | 2,4,4-trimethyl-3-[(2E,4E)-3-methyl-5-phosphanylpenta-2,4-dienyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 141144143 |
| Molecular Formula | C15H25OP |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,4,4-trimethyl-3-[(2E,4E)-3-methyl-5-phosphanylpenta-2,4-dienyl]cyclohex-2-en-1-ol |
| SMILES | CC1=C(C/C=C(C)/C=C/P)C(C)(C)CCC1O |
| InChI | InChI=1S/C15H25OP/c1-11(8-10-17)5-6-13-12(2)14(16)7-9-15(13,3)4/h5,8,10,14,16H,6-7,9,17H2,1-4H3/b10-8+,11-5+ |
| InChIKey | PHBNNTVOHVEOSR-BSJVZVMRSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|