C15H24O2 — CID 70590161
3-(4-hydroxyhexa-2,5-dien-2-yl)-2,4,4-trimethylcyclohex-2-en-1-ol (PubChem CID 70590161) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-(4-hydroxyhexa-2,5-dien-2-yl)-2,4,4-trimethylcyclohex-2-en-1-ol.
| Compound Name | 3-(4-hydroxyhexa-2,5-dien-2-yl)-2,4,4-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 70590161 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-(4-hydroxyhexa-2,5-dien-2-yl)-2,4,4-trimethylcyclohex-2-en-1-ol |
| SMILES | C=CC(O)C=C(C)C1=C(C)C(O)CCC1(C)C |
| InChI | InChI=1S/C15H24O2/c1-6-12(16)9-10(2)14-11(3)13(17)7-8-15(14,4)5/h6,9,12-13,16-17H,1,7-8H2,2-5H3 |
| InChIKey | HHDFCSOJTZJNEN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|