C10H12FNO6S — CID 141144852
2-amino-2-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroacetic acid (PubChem CID 141144852) has the molecular formula C10H12FNO6S and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-amino-2-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroacetic acid.
| Compound Name | 2-amino-2-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroacetic acid |
|---|---|
| PubChem CID | 141144852 |
| Molecular Formula | C10H12FNO6S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-amino-2-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroacetic acid |
| SMILES | COc1ccc(S(=O)(=O)C(N)(F)C(=O)O)cc1OC |
| InChI | InChI=1S/C10H12FNO6S/c1-17-7-4-3-6(5-8(7)18-2)19(15,16)10(11,12)9(13)14/h3-5H,12H2,1-2H3,(H,13,14) |
| InChIKey | JUINCMPDIZUEEE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|