C13H12ClNO2S — CID 141145970
3-[(1R)-1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide (PubChem CID 141145970) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide.
| Compound Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141145970 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide |
| SMILES | C[C@@H](Oc1ccsc1C(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H12ClNO2S/c1-8(9-4-2-3-5-10(9)14)17-11-6-7-18-12(11)13(15)16/h2-8H,1H3,(H2,15,16)/t8-/m1/s1 |
| InChIKey | ZTBCXHOUHPBWQO-MRVPVSSYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |