C14H14ClNO3S — CID 69371408
5-amino-3-[1-(2-chlorophenyl)ethoxy]-4-methylthiophene-2-carboxylic acid (PubChem CID 69371408) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is 5-amino-3-[1-(2-chlorophenyl)ethoxy]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 5-amino-3-[1-(2-chlorophenyl)ethoxy]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 69371408 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-amino-3-[1-(2-chlorophenyl)ethoxy]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1c(N)sc(C(=O)O)c1OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C14H14ClNO3S/c1-7-11(12(14(17)18)20-13(7)16)19-8(2)9-5-3-4-6-10(9)15/h3-6,8H,16H2,1-2H3,(H,17,18) |
| InChIKey | AUWPHZIRSYHIKM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |