C17H14ClNO4S — CID 66730324
methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(2-cyanoacetyl)thiophene-2-carboxylate (PubChem CID 66730324) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(2-cyanoacetyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(2-cyanoacetyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 66730324 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | methyl 3-[1-(2-chlorophenyl)ethoxy]-5-(2-cyanoacetyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C(=O)CC#N)cc1OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClNO4S/c1-10(11-5-3-4-6-12(11)18)23-14-9-15(13(20)7-8-19)24-16(14)17(21)22-2/h3-6,9-10H,7H2,1-2H3 |
| InChIKey | XSYYYVVMCODTCY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |