C30H18 — CID 141148781
1,2,3-triethynyl-4,5,6-triphenylbenzene (PubChem CID 141148781) has the molecular formula C30H18 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1,2,3-triethynyl-4,5,6-triphenylbenzene.
| Compound Name | 1,2,3-triethynyl-4,5,6-triphenylbenzene |
|---|---|
| PubChem CID | 141148781 |
| Molecular Formula | C30H18 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1,2,3-triethynyl-4,5,6-triphenylbenzene |
| SMILES | C#Cc1c(C#C)c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1C#C |
| InChI | InChI=1S/C30H18/c1-4-25-26(5-2)28(22-16-10-7-11-17-22)30(24-20-14-9-15-21-24)29(27(25)6-3)23-18-12-8-13-19-23/h1-3,7-21H |
| InChIKey | DYSIKCPPNAZQQD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|