C13H15NO4S — CID 141149782
(2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-sulfanylbutanoic acid (PubChem CID 141149782) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-sulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 141149782 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-sulfanylbutanoic acid |
| SMILES | CC(=O)Oc1ccccc1/C=N/[C@@H](CCS)C(=O)O |
| InChI | InChI=1S/C13H15NO4S/c1-9(15)18-12-5-3-2-4-10(12)8-14-11(6-7-19)13(16)17/h2-5,8,11,19H,6-7H2,1H3,(H,16,17)/b14-8+/t11-/m0/s1 |
| InChIKey | TZYXSQXCLAZAME-KYJZABPNSA-N |
| XLogP | 1.80 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|