C13H15NO5 — CID 141149836
(2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-hydroxybutanoic acid (PubChem CID 141149836) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 141149836 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2S)-2-[(2-acetyloxyphenyl)methylideneamino]-4-hydroxybutanoic acid |
| SMILES | CC(=O)Oc1ccccc1/C=N/[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C13H15NO5/c1-9(16)19-12-5-3-2-4-10(12)8-14-11(6-7-15)13(17)18/h2-5,8,11,15H,6-7H2,1H3,(H,17,18)/b14-8+/t11-/m0/s1 |
| InChIKey | SPRKVNTVFCPPPI-KYJZABPNSA-N |
| XLogP | 0.87 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|