C15H19NO7 — CID 141149831
[2-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]iminomethyl]phenyl] acetate (PubChem CID 141149831) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is [2-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]iminomethyl]phenyl] acetate.
| Compound Name | [2-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]iminomethyl]phenyl] acetate |
|---|---|
| PubChem CID | 141149831 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [2-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]iminomethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C=NC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19NO7/c1-8(18)22-10-5-3-2-4-9(10)6-16-15-14(21)13(20)12(19)11(7-17)23-15/h2-6,11-15,17,19-21H,7H2,1H3/t11-,12+,13+,14-,15?/m1/s1 |
| InChIKey | RKCYPYWWWHBUCQ-GVLTWOEFSA-N |
| XLogP | -1.17 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|