C11H17N — CID 141149808
5-(cyclohex-2-en-1-ylmethyl)-3,4-dihydro-2H-pyrrole (PubChem CID 141149808) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-(cyclohex-2-en-1-ylmethyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(cyclohex-2-en-1-ylmethyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 141149808 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 5-(cyclohex-2-en-1-ylmethyl)-3,4-dihydro-2H-pyrrole |
| SMILES | C1=CC(CC2=NCCC2)CCC1 |
| InChI | InChI=1S/C11H17N/c1-2-5-10(6-3-1)9-11-7-4-8-12-11/h2,5,10H,1,3-4,6-9H2 |
| InChIKey | SSUODRDWPDKXTP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|