C16H15N3O3S — CID 141151622
N-[(4-methylsulfonylphenyl)methyl]-1H-benzimidazole-4-carboxamide (PubChem CID 141151622) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 141151622 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2cccc3[nH]cnc23)cc1 |
| InChI | InChI=1S/C16H15N3O3S/c1-23(21,22)12-7-5-11(6-8-12)9-17-16(20)13-3-2-4-14-15(13)19-10-18-14/h2-8,10H,9H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | MCRYTHCOGIMLGQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |