C16H12N4OS — CID 141151618
N-(1,3-benzothiazol-2-ylmethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 141151618) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 141151618 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2s1)c1cccc2[nH]cnc12 |
| InChI | InChI=1S/C16H12N4OS/c21-16(10-4-3-6-12-15(10)19-9-18-12)17-8-14-20-11-5-1-2-7-13(11)22-14/h1-7,9H,8H2,(H,17,21)(H,18,19) |
| InChIKey | GZUNCVDSSXVKPQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |