C24H30N2O2 — CID 141158209
[4-(1-butylpiperidin-4-yl)oxyphenyl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 141158209) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is [4-(1-butylpiperidin-4-yl)oxyphenyl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [4-(1-butylpiperidin-4-yl)oxyphenyl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 141158209 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [4-(1-butylpiperidin-4-yl)oxyphenyl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | CCCCN1CCC(Oc2ccc(C(=O)N3CCc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-2-3-15-25-16-13-22(14-17-25)28-21-10-8-20(9-11-21)24(27)26-18-12-19-6-4-5-7-23(19)26/h4-11,22H,2-3,12-18H2,1H3 |
| InChIKey | RQMLVHNRZPYXNH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |