C11H20O7 — CID 141161998
1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 141161998) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 141161998 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-2,3,4-trihydroxyoxolan-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@]1(O)O[C@@H]([C@H](O)CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O7/c1-10(2,3)9(16)11(17)8(15)6(14)7(18-11)5(13)4-12/h5-8,12-15,17H,4H2,1-3H3/t5-,6+,7+,8-,11-/m1/s1 |
| InChIKey | CSJCBEQIOXNYBN-TXEDPVRZSA-N |
| XLogP | -2.24 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |