C19H27IO — CID 141162058
4-iodo-7-(2-methylhexan-2-yl)-1,2,3,4,4a,9b-hexahydrodibenzofuran (PubChem CID 141162058) has the molecular formula C19H27IO and a molecular weight of 398.33 g/mol. Its IUPAC name is 4-iodo-7-(2-methylhexan-2-yl)-1,2,3,4,4a,9b-hexahydrodibenzofuran.
| Compound Name | 4-iodo-7-(2-methylhexan-2-yl)-1,2,3,4,4a,9b-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 141162058 |
| Molecular Formula | C19H27IO |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-iodo-7-(2-methylhexan-2-yl)-1,2,3,4,4a,9b-hexahydrodibenzofuran |
| SMILES | CCCCC(C)(C)c1ccc2c(c1)OC1C(I)CCCC21 |
| InChI | InChI=1S/C19H27IO/c1-4-5-11-19(2,3)13-9-10-14-15-7-6-8-16(20)18(15)21-17(14)12-13/h9-10,12,15-16,18H,4-8,11H2,1-3H3 |
| InChIKey | VSWKKGKHHQHSEY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|