C13H9NS2 — CID 141162564
3-phenyl-4-thiophen-2-yl-1,2-thiazole (PubChem CID 141162564) has the molecular formula C13H9NS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is 3-phenyl-4-thiophen-2-yl-1,2-thiazole.
| Compound Name | 3-phenyl-4-thiophen-2-yl-1,2-thiazole |
|---|---|
| PubChem CID | 141162564 |
| Molecular Formula | C13H9NS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 3-phenyl-4-thiophen-2-yl-1,2-thiazole |
| SMILES | c1ccc(-c2nscc2-c2cccs2)cc1 |
| InChI | InChI=1S/C13H9NS2/c1-2-5-10(6-3-1)13-11(9-16-14-13)12-7-4-8-15-12/h1-9H |
| InChIKey | LIHPREYNICWJMB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |