About 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid
2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid (PubChem CID 141162587) has the molecular formula C8H8O4S
and a molecular weight of 200.21 g/mol. Its IUPAC name is 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid.
Molecular Properties
| Compound Name | 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid |
| PubChem CID | 141162587 |
| Molecular Formula | C8H8O4S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid |
| SMILES | CCc1c(S(=O)(=O)O)ccc2c1O2 |
| InChI | InChI=1S/C8H8O4S/c1-2-5-7(13(9,10)11)4-3-6-8(5)12-6/h3-4H,2H2,1H3,(H,9,10,11) |
| InChIKey | SOLDBRGNEUSRQT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid?
The IUPAC name of 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid (CID 141162587) is 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid.
What is the SMILES notation for 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid?
The canonical SMILES for 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid is CCc1c(S(=O)(=O)O)ccc2c1O2.
What is the InChIKey of 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid?
The InChIKey is SOLDBRGNEUSRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S/c1-2-5-7(13(9,10)11)4-3-6-8(5)12-6/h3-4H,2H2,1H3,(H,9,10,11).
What are the key properties of 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid?
2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid has a molecular weight of 200.21 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonic acid is sourced from PubChem (CID 141162587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).