C18H24O9S3Sn2 — CID 172750751
10,10-dioxo-1,9-bis(trimethylstannyl)phenoxathiine-4,6-disulfonic acid (PubChem CID 172750751) has the molecular formula C18H24O9S3Sn2 and a molecular weight of 718.00 g/mol. Its IUPAC name is 10,10-dioxo-1,9-bis(trimethylstannyl)phenoxathiine-4,6-disulfonic acid.
| Compound Name | 10,10-dioxo-1,9-bis(trimethylstannyl)phenoxathiine-4,6-disulfonic acid |
|---|---|
| PubChem CID | 172750751 |
| Molecular Formula | C18H24O9S3Sn2 |
| Molecular Weight | 718.00 g/mol |
| Exact Mass | 719.86 |
| IUPAC Name | 10,10-dioxo-1,9-bis(trimethylstannyl)phenoxathiine-4,6-disulfonic acid |
| SMILES | C[Sn](C)(C)c1ccc(S(=O)(=O)O)c2c1S(=O)(=O)c1c([Sn](C)(C)C)ccc(S(=O)(=O)O)c1O2 |
| InChI | InChI=1S/C12H6O9S3.6CH3.2Sn/c13-22(14)7-3-1-5-9(23(15,16)17)11(7)21-12-8(22)4-2-6-10(12)24(18,19)20;;;;;;;;/h1-2,5-6H,(H,15,16,17)(H,18,19,20);6*1H3;; |
| InChIKey | KIKVFINDGZUXOM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|