C16H18O9S3Sb2 — CID 172753740
1,9-bis(dimethylstiboryl)phenoxathiine-4,6-disulfonic acid (PubChem CID 172753740) has the molecular formula C16H18O9S3Sb2 and a molecular weight of 694.03 g/mol. Its IUPAC name is 1,9-bis(dimethylstiboryl)phenoxathiine-4,6-disulfonic acid.
| Compound Name | 1,9-bis(dimethylstiboryl)phenoxathiine-4,6-disulfonic acid |
|---|---|
| PubChem CID | 172753740 |
| Molecular Formula | C16H18O9S3Sb2 |
| Molecular Weight | 694.03 g/mol |
| Exact Mass | 691.82 |
| IUPAC Name | 1,9-bis(dimethylstiboryl)phenoxathiine-4,6-disulfonic acid |
| SMILES | C[Sb](C)(=O)c1ccc(S(=O)(=O)O)c2c1Sc1c([Sb](C)(C)=O)ccc(S(=O)(=O)O)c1O2 |
| InChI | InChI=1S/C12H6O7S3.4CH3.2O.2Sb/c13-21(14,15)9-5-1-3-7-11(9)19-12-8(20-7)4-2-6-10(12)22(16,17)18;;;;;;;;/h1-2,5-6H,(H,13,14,15)(H,16,17,18);4*1H3;;;; |
| InChIKey | KSQYFHYHEDPPLQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.03 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|