C16H18O7S2 — CID 144731392
2,7-dimethyl-9H-xanthene-4,5-disulfonic acid;methane (PubChem CID 144731392) has the molecular formula C16H18O7S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2,7-dimethyl-9H-xanthene-4,5-disulfonic acid;methane.
| Compound Name | 2,7-dimethyl-9H-xanthene-4,5-disulfonic acid;methane |
|---|---|
| PubChem CID | 144731392 |
| Molecular Formula | C16H18O7S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2,7-dimethyl-9H-xanthene-4,5-disulfonic acid;methane |
| SMILES | C.Cc1cc2c(c(S(=O)(=O)O)c1)Oc1c(cc(C)cc1S(=O)(=O)O)C2 |
| InChI | InChI=1S/C15H14O7S2.CH4/c1-8-3-10-7-11-4-9(2)6-13(24(19,20)21)15(11)22-14(10)12(5-8)23(16,17)18;/h3-6H,7H2,1-2H3,(H,16,17,18)(H,19,20,21);1H4 |
| InChIKey | BVFBPWVKQLDQGG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|