C12H18O3SSi — CID 87329719
2-[ethenyl(dimethyl)silyl]-3,5-dimethylbenzenesulfonic acid (PubChem CID 87329719) has the molecular formula C12H18O3SSi and a molecular weight of 270.43 g/mol. Its IUPAC name is 2-[ethenyl(dimethyl)silyl]-3,5-dimethylbenzenesulfonic acid.
| Compound Name | 2-[ethenyl(dimethyl)silyl]-3,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87329719 |
| Molecular Formula | C12H18O3SSi |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[ethenyl(dimethyl)silyl]-3,5-dimethylbenzenesulfonic acid |
| SMILES | C=C[Si](C)(C)c1c(C)cc(C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H18O3SSi/c1-6-17(4,5)12-10(3)7-9(2)8-11(12)16(13,14)15/h6-8H,1H2,2-5H3,(H,13,14,15) |
| InChIKey | HHCOFCHTHFIXJQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|