C17H20O8S2Sb2 — CID 172691321
1,8-bis(dimethylstiboryl)-9H-fluorene-4,5-disulfonic acid (PubChem CID 172691321) has the molecular formula C17H20O8S2Sb2 and a molecular weight of 659.99 g/mol. Its IUPAC name is 1,8-bis(dimethylstiboryl)-9H-fluorene-4,5-disulfonic acid.
| Compound Name | 1,8-bis(dimethylstiboryl)-9H-fluorene-4,5-disulfonic acid |
|---|---|
| PubChem CID | 172691321 |
| Molecular Formula | C17H20O8S2Sb2 |
| Molecular Weight | 659.99 g/mol |
| Exact Mass | 657.87 |
| IUPAC Name | 1,8-bis(dimethylstiboryl)-9H-fluorene-4,5-disulfonic acid |
| SMILES | C[Sb](C)(=O)c1ccc(S(=O)(=O)O)c2c1Cc1c([Sb](C)(C)=O)ccc(S(=O)(=O)O)c1-2 |
| InChI | InChI=1S/C13H8O6S2.4CH3.2O.2Sb/c14-20(15,16)10-5-1-3-8-7-9-4-2-6-11(21(17,18)19)13(9)12(8)10;;;;;;;;/h1-2,5-6H,7H2,(H,14,15,16)(H,17,18,19);4*1H3;;;; |
| InChIKey | BSHMXJTXGRDIOD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.99 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|