C17H20O8S3Sb2 — CID 172773398
8,9-bis(dimethylstiboryl)-9H-thioxanthene-3,5-disulfonic acid (PubChem CID 172773398) has the molecular formula C17H20O8S3Sb2 and a molecular weight of 692.06 g/mol. Its IUPAC name is 8,9-bis(dimethylstiboryl)-9H-thioxanthene-3,5-disulfonic acid.
| Compound Name | 8,9-bis(dimethylstiboryl)-9H-thioxanthene-3,5-disulfonic acid |
|---|---|
| PubChem CID | 172773398 |
| Molecular Formula | C17H20O8S3Sb2 |
| Molecular Weight | 692.06 g/mol |
| Exact Mass | 689.84 |
| IUPAC Name | 8,9-bis(dimethylstiboryl)-9H-thioxanthene-3,5-disulfonic acid |
| SMILES | C[Sb](C)(=O)c1ccc(S(=O)(=O)O)c2c1C([Sb](C)(C)=O)c1ccc(S(=O)(=O)O)cc1S2 |
| InChI | InChI=1S/C13H8O6S3.4CH3.2O.2Sb/c14-21(15,16)10-5-4-8-6-9-2-1-3-12(22(17,18)19)13(9)20-11(8)7-10;;;;;;;;/h1,3-7H,(H,14,15,16)(H,17,18,19);4*1H3;;;; |
| InChIKey | NGMIGYCDWKYASD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.06 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|