C10H10N2O5S — CID 22642174
8-ethyl-2,4-dioxo-1H-quinazoline-7-sulfonic acid (PubChem CID 22642174) has the molecular formula C10H10N2O5S and a molecular weight of 270.27 g/mol. Its IUPAC name is 8-ethyl-2,4-dioxo-1H-quinazoline-7-sulfonic acid.
| Compound Name | 8-ethyl-2,4-dioxo-1H-quinazoline-7-sulfonic acid |
|---|---|
| PubChem CID | 22642174 |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 8-ethyl-2,4-dioxo-1H-quinazoline-7-sulfonic acid |
| SMILES | CCc1c(S(=O)(=O)O)ccc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C10H10N2O5S/c1-2-5-7(18(15,16)17)4-3-6-8(5)11-10(14)12-9(6)13/h3-4H,2H2,1H3,(H,15,16,17)(H2,11,12,13,14) |
| InChIKey | FFYJSHZEMLZUNV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|