C10H7N3OS — CID 141163647
2-(furan-2-ylsulfanyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 141163647) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-(furan-2-ylsulfanyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(furan-2-ylsulfanyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 141163647 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-(furan-2-ylsulfanyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | c1coc(Sc2nc3ncccc3[nH]2)c1 |
| InChI | InChI=1S/C10H7N3OS/c1-3-7-9(11-5-1)13-10(12-7)15-8-4-2-6-14-8/h1-6H,(H,11,12,13) |
| InChIKey | HZDVSZFKPDFULL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |