C20H22BrN3O2S — CID 141165300
N-[4-(2-bromoindol-1-yl)sulfonylphenyl]-1-methylpiperidin-4-amine (PubChem CID 141165300) has the molecular formula C20H22BrN3O2S and a molecular weight of 448.39 g/mol. Its IUPAC name is N-[4-(2-bromoindol-1-yl)sulfonylphenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[4-(2-bromoindol-1-yl)sulfonylphenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 141165300 |
| Molecular Formula | C20H22BrN3O2S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | N-[4-(2-bromoindol-1-yl)sulfonylphenyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(Nc2ccc(S(=O)(=O)n3c(Br)cc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C20H22BrN3O2S/c1-23-12-10-17(11-13-23)22-16-6-8-18(9-7-16)27(25,26)24-19-5-3-2-4-15(19)14-20(24)21/h2-9,14,17,22H,10-13H2,1H3 |
| InChIKey | NDIASDITHHYHFR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |