C13H20O2 — CID 141165954
6-heptyl-6-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 141165954) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 6-heptyl-6-hydroxycyclohexa-2,4-dien-1-one.
| Compound Name | 6-heptyl-6-hydroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141165954 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 6-heptyl-6-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCCC1(O)C=CC=CC1=O |
| InChI | InChI=1S/C13H20O2/c1-2-3-4-5-7-10-13(15)11-8-6-9-12(13)14/h6,8-9,11,15H,2-5,7,10H2,1H3 |
| InChIKey | HUGPMYZBBCUPNS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|