C18H18F2N4O2S — CID 141167862
3-(2,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-2H-indazole (PubChem CID 141167862) has the molecular formula C18H18F2N4O2S and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-2H-indazole.
| Compound Name | 3-(2,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-2H-indazole |
|---|---|
| PubChem CID | 141167862 |
| Molecular Formula | C18H18F2N4O2S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-2H-indazole |
| SMILES | CN1CCN(c2ccc3n[nH]c(S(=O)(=O)c4ccc(F)cc4F)c3c2)CC1 |
| InChI | InChI=1S/C18H18F2N4O2S/c1-23-6-8-24(9-7-23)13-3-4-16-14(11-13)18(22-21-16)27(25,26)17-5-2-12(19)10-15(17)20/h2-5,10-11H,6-9H2,1H3,(H,21,22) |
| InChIKey | KUSAPNURQTYIIW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |