C9H6ClFN2O3S — CID 141168061
(2-chloro-1,7-naphthyridin-8-yl) fluoromethanesulfonate (PubChem CID 141168061) has the molecular formula C9H6ClFN2O3S and a molecular weight of 276.68 g/mol. Its IUPAC name is (2-chloro-1,7-naphthyridin-8-yl) fluoromethanesulfonate.
| Compound Name | (2-chloro-1,7-naphthyridin-8-yl) fluoromethanesulfonate |
|---|---|
| PubChem CID | 141168061 |
| Molecular Formula | C9H6ClFN2O3S |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | (2-chloro-1,7-naphthyridin-8-yl) fluoromethanesulfonate |
| SMILES | O=S(=O)(CF)Oc1nccc2ccc(Cl)nc12 |
| InChI | InChI=1S/C9H6ClFN2O3S/c10-7-2-1-6-3-4-12-9(8(6)13-7)16-17(14,15)5-11/h1-4H,5H2 |
| InChIKey | QUVAJZCWYQUKFA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|