C26H36O — CID 141168167
2-butyl-6-[(3-tert-butyl-5-methyl-2-prop-1-enylphenyl)methyl]-4-methylphenol (PubChem CID 141168167) has the molecular formula C26H36O and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-butyl-6-[(3-tert-butyl-5-methyl-2-prop-1-enylphenyl)methyl]-4-methylphenol.
| Compound Name | 2-butyl-6-[(3-tert-butyl-5-methyl-2-prop-1-enylphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 141168167 |
| Molecular Formula | C26H36O |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 2-butyl-6-[(3-tert-butyl-5-methyl-2-prop-1-enylphenyl)methyl]-4-methylphenol |
| SMILES | CC=Cc1c(Cc2cc(C)cc(CCCC)c2O)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C26H36O/c1-8-10-12-20-13-18(3)15-22(25(20)27)17-21-14-19(4)16-24(26(5,6)7)23(21)11-9-2/h9,11,13-16,27H,8,10,12,17H2,1-7H3 |
| InChIKey | DLPSDCWZHDTODM-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |