C21H22ClN3O3S — CID 141170355
2-[3-[2-[[1-(6-chloro-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]amino]ethoxy]phenyl]acetic acid (PubChem CID 141170355) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is 2-[3-[2-[[1-(6-chloro-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]amino]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[[1-(6-chloro-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]amino]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 141170355 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[3-[2-[[1-(6-chloro-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]amino]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCCNC2CCN(c3nc4ccc(Cl)cc4s3)C2)c1 |
| InChI | InChI=1S/C21H22ClN3O3S/c22-15-4-5-18-19(12-15)29-21(24-18)25-8-6-16(13-25)23-7-9-28-17-3-1-2-14(10-17)11-20(26)27/h1-5,10,12,16,23H,6-9,11,13H2,(H,26,27) |
| InChIKey | KUOKYFOTEKYRPR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|