C22H23IN2O2S2 — CID 71083390
2-[3-[2-[1-(6-iodo-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylsulfanyl]phenyl]acetic acid (PubChem CID 71083390) has the molecular formula C22H23IN2O2S2 and a molecular weight of 538.48 g/mol. Its IUPAC name is 2-[3-[2-[1-(6-iodo-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylsulfanyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[1-(6-iodo-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylsulfanyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 71083390 |
| Molecular Formula | C22H23IN2O2S2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 2-[3-[2-[1-(6-iodo-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylsulfanyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(SCCC2CCN(c3nc4ccc(I)cc4s3)CC2)c1 |
| InChI | InChI=1S/C22H23IN2O2S2/c23-17-4-5-19-20(14-17)29-22(24-19)25-9-6-15(7-10-25)8-11-28-18-3-1-2-16(12-18)13-21(26)27/h1-5,12,14-15H,6-11,13H2,(H,26,27) |
| InChIKey | NGJUVRGPFUSMBO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|