C17H22O3S — CID 141172952
3-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid (PubChem CID 141172952) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid.
| Compound Name | 3-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 141172952 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid |
| SMILES | CC12CCC(C/C1=C\c1cccc(S(=O)(=O)O)c1)C2(C)C |
| InChI | InChI=1S/C17H22O3S/c1-16(2)13-7-8-17(16,3)14(11-13)9-12-5-4-6-15(10-12)21(18,19)20/h4-6,9-10,13H,7-8,11H2,1-3H3,(H,18,19,20)/b14-9+ |
| InChIKey | QNFXCNFCJJLIMZ-NTEUORMPSA-N |
| XLogP | 4.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|