C20H26O2 — CID 141175239
[2-(2-ethenylphenyl)-1-ethylcyclohexyl] 2-methylprop-2-enoate (PubChem CID 141175239) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is [2-(2-ethenylphenyl)-1-ethylcyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-ethenylphenyl)-1-ethylcyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141175239 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [2-(2-ethenylphenyl)-1-ethylcyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=Cc1ccccc1C1CCCCC1(CC)OC(=O)C(=C)C |
| InChI | InChI=1S/C20H26O2/c1-5-16-11-7-8-12-17(16)18-13-9-10-14-20(18,6-2)22-19(21)15(3)4/h5,7-8,11-12,18H,1,3,6,9-10,13-14H2,2,4H3 |
| InChIKey | LKQZLRPJBMXFCE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|